C20H25N3O — CID 129361785
(4R)-1-N-(2-methoxy-9-methylacridin-4-yl)pentane-1,4-diamine (PubChem CID 129361785) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (4R)-1-N-(2-methoxy-9-methylacridin-4-yl)pentane-1,4-diamine.
| Compound Name | (4R)-1-N-(2-methoxy-9-methylacridin-4-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 129361785 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (4R)-1-N-(2-methoxy-9-methylacridin-4-yl)pentane-1,4-diamine |
| SMILES | COc1cc(NCCC[C@@H](C)N)c2nc3ccccc3c(C)c2c1 |
| InChI | InChI=1S/C20H25N3O/c1-13(21)7-6-10-22-19-12-15(24-3)11-17-14(2)16-8-4-5-9-18(16)23-20(17)19/h4-5,8-9,11-13,22H,6-7,10,21H2,1-3H3/t13-/m1/s1 |
| InChIKey | BZJZKHNOWYNABG-CYBMUJFWSA-N |
| XLogP | 4.24 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|