C14H16O5 — CID 129363775
methyl 3-[(3S)-3-hydroxy-4,4-dimethoxybut-1-ynyl]benzoate (PubChem CID 129363775) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 3-[(3S)-3-hydroxy-4,4-dimethoxybut-1-ynyl]benzoate.
| Compound Name | methyl 3-[(3S)-3-hydroxy-4,4-dimethoxybut-1-ynyl]benzoate |
|---|---|
| PubChem CID | 129363775 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | methyl 3-[(3S)-3-hydroxy-4,4-dimethoxybut-1-ynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#C[C@H](O)C(OC)OC)c1 |
| InChI | InChI=1S/C14H16O5/c1-17-13(16)11-6-4-5-10(9-11)7-8-12(15)14(18-2)19-3/h4-6,9,12,14-15H,1-3H3/t12-/m0/s1 |
| InChIKey | RVGSESQTEKBPFH-LBPRGKRZSA-N |
| XLogP | 0.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|