About S-[(1S)-1-butoxyethyl] ethanethioate
S-[(1S)-1-butoxyethyl] ethanethioate (PubChem CID 129365643) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is S-[(1S)-1-butoxyethyl] ethanethioate.
Molecular Properties
| Compound Name | S-[(1S)-1-butoxyethyl] ethanethioate |
| PubChem CID | 129365643 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | S-[(1S)-1-butoxyethyl] ethanethioate |
| SMILES | CCCCO[C@H](C)SC(C)=O |
| InChI | InChI=1S/C8H16O2S/c1-4-5-6-10-8(3)11-7(2)9/h8H,4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | LTWKNWPEJBUNRW-QMMMGPOBSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(1S)-1-butoxyethyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(1S)-1-butoxyethyl] ethanethioate?
The IUPAC name of S-[(1S)-1-butoxyethyl] ethanethioate (CID 129365643) is S-[(1S)-1-butoxyethyl] ethanethioate.
What is the SMILES notation for S-[(1S)-1-butoxyethyl] ethanethioate?
The canonical SMILES for S-[(1S)-1-butoxyethyl] ethanethioate is CCCCO[C@H](C)SC(C)=O.
What is the InChIKey of S-[(1S)-1-butoxyethyl] ethanethioate?
The InChIKey is LTWKNWPEJBUNRW-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H16O2S/c1-4-5-6-10-8(3)11-7(2)9/h8H,4-6H2,1-3H3/t8-/m0/s1.
What are the key properties of S-[(1S)-1-butoxyethyl] ethanethioate?
S-[(1S)-1-butoxyethyl] ethanethioate has a molecular weight of 176.28 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(1S)-1-butoxyethyl] ethanethioate is sourced from PubChem (CID 129365643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).