C10H16N4O3S2 — CID 129367136
1-[(3R)-1,1-dioxothiolan-3-yl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 129367136) has the molecular formula C10H16N4O3S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 129367136 |
| Molecular Formula | C10H16N4O3S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCc1nnc(NC(=O)N[C@@H]2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C10H16N4O3S2/c1-2-3-8-13-14-10(18-8)12-9(15)11-7-4-5-19(16,17)6-7/h7H,2-6H2,1H3,(H2,11,12,14,15)/t7-/m1/s1 |
| InChIKey | GLBRFLKQWDELGS-SSDOTTSWSA-N |
| XLogP | 0.80 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |