C10H17F3OSi — CID 12937201
trimethyl-[4-(trifluoromethyl)cyclohexen-1-yl]oxysilane (PubChem CID 12937201) has the molecular formula C10H17F3OSi and a molecular weight of 238.32 g/mol. Its IUPAC name is trimethyl-[4-(trifluoromethyl)cyclohexen-1-yl]oxysilane.
| Compound Name | trimethyl-[4-(trifluoromethyl)cyclohexen-1-yl]oxysilane |
|---|---|
| PubChem CID | 12937201 |
| Molecular Formula | C10H17F3OSi |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | trimethyl-[4-(trifluoromethyl)cyclohexen-1-yl]oxysilane |
| SMILES | C[Si](C)(C)OC1=CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H17F3OSi/c1-15(2,3)14-9-6-4-8(5-7-9)10(11,12)13/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | KVJUODCEDRXDNP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|