C14H26F2OSi — CID 122389927
tert-butyl-(4,4-difluoro-3-propylcyclopenten-1-yl)oxy-dimethylsilane (PubChem CID 122389927) has the molecular formula C14H26F2OSi and a molecular weight of 276.44 g/mol. Its IUPAC name is tert-butyl-(4,4-difluoro-3-propylcyclopenten-1-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(4,4-difluoro-3-propylcyclopenten-1-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 122389927 |
| Molecular Formula | C14H26F2OSi |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | tert-butyl-(4,4-difluoro-3-propylcyclopenten-1-yl)oxy-dimethylsilane |
| SMILES | CCCC1C=C(O[Si](C)(C)C(C)(C)C)CC1(F)F |
| InChI | InChI=1S/C14H26F2OSi/c1-7-8-11-9-12(10-14(11,15)16)17-18(5,6)13(2,3)4/h9,11H,7-8,10H2,1-6H3 |
| InChIKey | DPSDMNDVAYQVHV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|