C33H49F3O2Si2 — CID 177494411
tert-butyl-dimethyl-[4-phenyl-3-[4-(trifluoromethyl)phenyl]-4-tri(propan-2-yl)silyloxycyclopenten-1-yl]oxysilane (PubChem CID 177494411) has the molecular formula C33H49F3O2Si2 and a molecular weight of 590.92 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-phenyl-3-[4-(trifluoromethyl)phenyl]-4-tri(propan-2-yl)silyloxycyclopenten-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[4-phenyl-3-[4-(trifluoromethyl)phenyl]-4-tri(propan-2-yl)silyloxycyclopenten-1-yl]oxysilane |
|---|---|
| PubChem CID | 177494411 |
| Molecular Formula | C33H49F3O2Si2 |
| Molecular Weight | 590.92 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | tert-butyl-dimethyl-[4-phenyl-3-[4-(trifluoromethyl)phenyl]-4-tri(propan-2-yl)silyloxycyclopenten-1-yl]oxysilane |
| SMILES | CC(C)[Si](OC1(c2ccccc2)CC(O[Si](C)(C)C(C)(C)C)=CC1c1ccc(C(F)(F)F)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H49F3O2Si2/c1-23(2)40(24(3)4,25(5)6)38-32(27-15-13-12-14-16-27)22-29(37-39(10,11)31(7,8)9)21-30(32)26-17-19-28(20-18-26)33(34,35)36/h12-21,23-25,30H,22H2,1-11H3 |
| InChIKey | NBVBDQZOPQPSJM-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.92 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|