C38H36BF12OP — CID 164678164
2,2-bis[3,5-bis(trifluoromethyl)phenyl]-4,4-ditert-butyl-5,5-diphenyl-1-oxa-4-phosphonia-2-boranuidacyclopentane (PubChem CID 164678164) has the molecular formula C38H36BF12OP and a molecular weight of 778.47 g/mol. Its IUPAC name is 2,2-bis[3,5-bis(trifluoromethyl)phenyl]-4,4-ditert-butyl-5,5-diphenyl-1-oxa-4-phosphonia-2-boranuidacyclopentane.
| Compound Name | 2,2-bis[3,5-bis(trifluoromethyl)phenyl]-4,4-ditert-butyl-5,5-diphenyl-1-oxa-4-phosphonia-2-boranuidacyclopentane |
|---|---|
| PubChem CID | 164678164 |
| Molecular Formula | C38H36BF12OP |
| Molecular Weight | 778.47 g/mol |
| Exact Mass | 778.24 |
| IUPAC Name | 2,2-bis[3,5-bis(trifluoromethyl)phenyl]-4,4-ditert-butyl-5,5-diphenyl-1-oxa-4-phosphonia-2-boranuidacyclopentane |
| SMILES | CC(C)(C)[P+]1(C(C)(C)C)C[B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H36BF12OP/c1-32(2,3)53(33(4,5)6)23-39(30-19-26(35(40,41)42)17-27(20-30)36(43,44)45,31-21-28(37(46,47)48)18-29(22-31)38(49,50)51)52-34(53,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-22H,23H2,1-6H3 |
| InChIKey | UGXJHZHIUHRFMZ-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.47 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|