C21H14F12O2 — CID 89263159
2,2-bis[3,5-bis(trifluoromethyl)phenyl]-5-methyl-1,3-dioxane (PubChem CID 89263159) has the molecular formula C21H14F12O2 and a molecular weight of 526.32 g/mol. Its IUPAC name is 2,2-bis[3,5-bis(trifluoromethyl)phenyl]-5-methyl-1,3-dioxane.
| Compound Name | 2,2-bis[3,5-bis(trifluoromethyl)phenyl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 89263159 |
| Molecular Formula | C21H14F12O2 |
| Molecular Weight | 526.32 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 2,2-bis[3,5-bis(trifluoromethyl)phenyl]-5-methyl-1,3-dioxane |
| SMILES | CC1COC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC1 |
| InChI | InChI=1S/C21H14F12O2/c1-10-8-34-17(35-9-10,11-2-13(18(22,23)24)6-14(3-11)19(25,26)27)12-4-15(20(28,29)30)7-16(5-12)21(31,32)33/h2-7,10H,8-9H2,1H3 |
| InChIKey | ORNYHGUBWNUSHN-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.32 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |