C30H33F6IO2 — CID 89263166
5-[4-(4-iodocyclohexyl)cyclohexyl]-2,2-bis[4-(trifluoromethyl)phenyl]-1,3-dioxane (PubChem CID 89263166) has the molecular formula C30H33F6IO2 and a molecular weight of 666.48 g/mol. Its IUPAC name is 5-[4-(4-iodocyclohexyl)cyclohexyl]-2,2-bis[4-(trifluoromethyl)phenyl]-1,3-dioxane.
| Compound Name | 5-[4-(4-iodocyclohexyl)cyclohexyl]-2,2-bis[4-(trifluoromethyl)phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 89263166 |
| Molecular Formula | C30H33F6IO2 |
| Molecular Weight | 666.48 g/mol |
| Exact Mass | 666.14 |
| IUPAC Name | 5-[4-(4-iodocyclohexyl)cyclohexyl]-2,2-bis[4-(trifluoromethyl)phenyl]-1,3-dioxane |
| SMILES | FC(F)(F)c1ccc(C2(c3ccc(C(F)(F)F)cc3)OCC(C3CCC(C4CCC(I)CC4)CC3)CO2)cc1 |
| InChI | InChI=1S/C30H33F6IO2/c31-29(32,33)25-11-7-23(8-12-25)28(24-9-13-26(14-10-24)30(34,35)36)38-17-22(18-39-28)21-3-1-19(2-4-21)20-5-15-27(37)16-6-20/h7-14,19-22,27H,1-6,15-18H2 |
| InChIKey | XPTBLJKRRDEREL-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.48 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|