C12H7Cl3F6O — CID 154095982
2-[3,5-bis(trifluoromethyl)phenyl]-2-(2,2,2-trichloroethyl)oxirane (PubChem CID 154095982) has the molecular formula C12H7Cl3F6O and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2,2,2-trichloroethyl)oxirane.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2,2,2-trichloroethyl)oxirane |
|---|---|
| PubChem CID | 154095982 |
| Molecular Formula | C12H7Cl3F6O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-(2,2,2-trichloroethyl)oxirane |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)cc(C2(CC(Cl)(Cl)Cl)CO2)c1 |
| InChI | InChI=1S/C12H7Cl3F6O/c13-10(14,15)4-9(5-22-9)6-1-7(11(16,17)18)3-8(2-6)12(19,20)21/h1-3H,4-5H2 |
| InChIKey | MKZJAYOXIZTEDD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|