C12H6Cl2F6O2 — CID 177305292
1-[3,5-bis(trifluoromethyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid (PubChem CID 177305292) has the molecular formula C12H6Cl2F6O2 and a molecular weight of 367.07 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 177305292 |
| Molecular Formula | C12H6Cl2F6O2 |
| Molecular Weight | 367.07 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2,2-dichlorocyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1(Cl)Cl |
| InChI | InChI=1S/C12H6Cl2F6O2/c13-10(14)4-9(10,8(21)22)5-1-6(11(15,16)17)3-7(2-5)12(18,19)20/h1-3H,4H2,(H,21,22) |
| InChIKey | GSAWWLKHKITDHA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.07 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|