About 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen
1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen (PubChem CID 162075104) has the molecular formula C13H16F6N2O
and a molecular weight of 330.27 g/mol. Its IUPAC name is 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen.
Molecular Properties
| Compound Name | 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen |
| PubChem CID | 162075104 |
| Molecular Formula | C13H16F6N2O |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen |
| SMILES | CNC(=O)NC1(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C13H12F6N2O.2H2/c1-20-10(22)21-11(2-3-11)7-4-8(12(14,15)16)6-9(5-7)13(17,18)19;;/h4-6H,2-3H2,1H3,(H2,20,21,22);2*1H |
| InChIKey | ZBPJFJXGIJBACC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen?
The IUPAC name of 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen (CID 162075104) is 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen.
What is the SMILES notation for 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen?
The canonical SMILES for 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen is CNC(=O)NC1(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1.[H][H].[H][H].
What is the InChIKey of 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen?
The InChIKey is ZBPJFJXGIJBACC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F6N2O.2H2/c1-20-10(22)21-11(2-3-11)7-4-8(12(14,15)16)6-9(5-7)13(17,18)19;;/h4-6H,2-3H2,1H3,(H2,20,21,22);2*1H.
What are the key properties of 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen?
1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen has a molecular weight of 330.27 g/mol, XLogP of 4.13, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[3,5-bis(trifluoromethyl)phenyl]cyclopropyl]-3-methylurea;molecular hydrogen is sourced from PubChem (CID 162075104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).