C13H9F6NO3 — CID 90237915
[1-[3,5-bis(trifluoromethyl)benzoyl]cyclopropyl]carbamic acid (PubChem CID 90237915) has the molecular formula C13H9F6NO3 and a molecular weight of 341.21 g/mol. Its IUPAC name is [1-[3,5-bis(trifluoromethyl)benzoyl]cyclopropyl]carbamic acid.
| Compound Name | [1-[3,5-bis(trifluoromethyl)benzoyl]cyclopropyl]carbamic acid |
|---|---|
| PubChem CID | 90237915 |
| Molecular Formula | C13H9F6NO3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | [1-[3,5-bis(trifluoromethyl)benzoyl]cyclopropyl]carbamic acid |
| SMILES | O=C(O)NC1(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C13H9F6NO3/c14-12(15,16)7-3-6(4-8(5-7)13(17,18)19)9(21)11(1-2-11)20-10(22)23/h3-5,20H,1-2H2,(H,22,23) |
| InChIKey | AFIYPRFZXPBSHI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |