C30H48O2SSi2 — CID 177471883
tert-butyl-dimethyl-[4-phenyl-3-thiophen-2-yl-4-tri(propan-2-yl)silyloxycyclopenten-1-yl]oxysilane (PubChem CID 177471883) has the molecular formula C30H48O2SSi2 and a molecular weight of 528.95 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-phenyl-3-thiophen-2-yl-4-tri(propan-2-yl)silyloxycyclopenten-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[4-phenyl-3-thiophen-2-yl-4-tri(propan-2-yl)silyloxycyclopenten-1-yl]oxysilane |
|---|---|
| PubChem CID | 177471883 |
| Molecular Formula | C30H48O2SSi2 |
| Molecular Weight | 528.95 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | tert-butyl-dimethyl-[4-phenyl-3-thiophen-2-yl-4-tri(propan-2-yl)silyloxycyclopenten-1-yl]oxysilane |
| SMILES | CC(C)[Si](OC1(c2ccccc2)CC(O[Si](C)(C)C(C)(C)C)=CC1c1cccs1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H48O2SSi2/c1-22(2)35(23(3)4,24(5)6)32-30(25-16-13-12-14-17-25)21-26(31-34(10,11)29(7,8)9)20-27(30)28-18-15-19-33-28/h12-20,22-24,27H,21H2,1-11H3 |
| InChIKey | VKIYIPLNJCHLKN-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.95 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|