C14H16I3NO3 — CID 129373350
(2R)-2-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl]butanoic acid (PubChem CID 129373350) has the molecular formula C14H16I3NO3 and a molecular weight of 627.00 g/mol. Its IUPAC name is (2R)-2-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl]butanoic acid.
| Compound Name | (2R)-2-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl]butanoic acid |
|---|---|
| PubChem CID | 129373350 |
| Molecular Formula | C14H16I3NO3 |
| Molecular Weight | 627.00 g/mol |
| Exact Mass | 626.83 |
| IUPAC Name | (2R)-2-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenyl]butanoic acid |
| SMILES | CC[C@@H](C(=O)O)c1c(I)cc(I)c(N(CC)C(C)=O)c1I |
| InChI | InChI=1S/C14H16I3NO3/c1-4-8(14(20)21)11-9(15)6-10(16)13(12(11)17)18(5-2)7(3)19/h6,8H,4-5H2,1-3H3,(H,20,21)/t8-/m1/s1 |
| InChIKey | IXPFNDDSBURDAF-MRVPVSSYSA-N |
| XLogP | 4.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.00 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|