C11H11ClI3NO — CID 175364773
3-(diethylamino)-2,4,6-triiodobenzoyl chloride (PubChem CID 175364773) has the molecular formula C11H11ClI3NO and a molecular weight of 589.38 g/mol. Its IUPAC name is 3-(diethylamino)-2,4,6-triiodobenzoyl chloride.
| Compound Name | 3-(diethylamino)-2,4,6-triiodobenzoyl chloride |
|---|---|
| PubChem CID | 175364773 |
| Molecular Formula | C11H11ClI3NO |
| Molecular Weight | 589.38 g/mol |
| Exact Mass | 588.77 |
| IUPAC Name | 3-(diethylamino)-2,4,6-triiodobenzoyl chloride |
| SMILES | CCN(CC)c1c(I)cc(I)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C11H11ClI3NO/c1-3-16(4-2)10-7(14)5-6(13)8(9(10)15)11(12)17/h5H,3-4H2,1-2H3 |
| InChIKey | ILDDZPBNVIWVGQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|