3-(diethylamino)-2,4,6-triiodobenzoyl chloride

C11H11ClI3NO — CID 175364773

IUPAC3-(diethylamino)-2,4,6-triiodobenzoyl chloride
SMILESCCN(CC)c1c(I)cc(I)c(C(=O)Cl)c1I
InChIInChI=1S/C11H11ClI3NO/c1-3-16(4-2)10-7(14)5-6(13)8(9(10)15)11(12)17/h5H,3-4H2,1-2H3
InChIKeyILDDZPBNVIWVGQ-UHFFFAOYSA-N
MW589.38 g/mol
LogP4.73
Rot. Bonds4

About 3-(diethylamino)-2,4,6-triiodobenzoyl chloride

3-(diethylamino)-2,4,6-triiodobenzoyl chloride (PubChem CID 175364773) has the molecular formula C11H11ClI3NO and a molecular weight of 589.38 g/mol. Its IUPAC name is 3-(diethylamino)-2,4,6-triiodobenzoyl chloride.

Molecular Properties

Compound Name3-(diethylamino)-2,4,6-triiodobenzoyl chloride
PubChem CID175364773
Molecular FormulaC11H11ClI3NO
Molecular Weight589.38 g/mol
Exact Mass588.77
IUPAC Name3-(diethylamino)-2,4,6-triiodobenzoyl chloride
SMILESCCN(CC)c1c(I)cc(I)c(C(=O)Cl)c1I
InChIInChI=1S/C11H11ClI3NO/c1-3-16(4-2)10-7(14)5-6(13)8(9(10)15)11(12)17/h5H,3-4H2,1-2H3
InChIKeyILDDZPBNVIWVGQ-UHFFFAOYSA-N
XLogP4.73
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500589.38
LogP ≤ 54.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 3-(diethylamino)-2,4,6-triiodobenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(diethylamino)-2,4,6-triiodobenzoyl chloride?
The IUPAC name of 3-(diethylamino)-2,4,6-triiodobenzoyl chloride (CID 175364773) is 3-(diethylamino)-2,4,6-triiodobenzoyl chloride.
What is the SMILES notation for 3-(diethylamino)-2,4,6-triiodobenzoyl chloride?
The canonical SMILES for 3-(diethylamino)-2,4,6-triiodobenzoyl chloride is CCN(CC)c1c(I)cc(I)c(C(=O)Cl)c1I.
What is the InChIKey of 3-(diethylamino)-2,4,6-triiodobenzoyl chloride?
The InChIKey is ILDDZPBNVIWVGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClI3NO/c1-3-16(4-2)10-7(14)5-6(13)8(9(10)15)11(12)17/h5H,3-4H2,1-2H3.
What are the key properties of 3-(diethylamino)-2,4,6-triiodobenzoyl chloride?
3-(diethylamino)-2,4,6-triiodobenzoyl chloride has a molecular weight of 589.38 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)-2,4,6-triiodobenzoyl chloride is sourced from PubChem (CID 175364773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).