About 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate
2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate (PubChem CID 54455053) has the molecular formula C19H20ClI3N2O7
and a molecular weight of 804.54 g/mol. Its IUPAC name is 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate.
Molecular Properties
| Compound Name | 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate |
| PubChem CID | 54455053 |
| Molecular Formula | C19H20ClI3N2O7 |
| Molecular Weight | 804.54 g/mol |
| Exact Mass | 803.81 |
| IUPAC Name | 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate |
| SMILES | CC(=O)OCCN(C(C)=O)c1c(I)c(C(=O)Cl)c(I)c(N(CCOC(C)=O)C(C)=O)c1I |
| InChI | InChI=1S/C19H20ClI3N2O7/c1-9(26)24(5-7-31-11(3)28)17-14(21)13(19(20)30)15(22)18(16(17)23)25(10(2)27)6-8-32-12(4)29/h5-8H2,1-4H3 |
| InChIKey | WXQAFGHOIBLXCC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 804.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate?
The IUPAC name of 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate (CID 54455053) is 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate.
What is the SMILES notation for 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate?
The canonical SMILES for 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate is CC(=O)OCCN(C(C)=O)c1c(I)c(C(=O)Cl)c(I)c(N(CCOC(C)=O)C(C)=O)c1I.
What is the InChIKey of 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate?
The InChIKey is WXQAFGHOIBLXCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClI3N2O7/c1-9(26)24(5-7-31-11(3)28)17-14(21)13(19(20)30)15(22)18(16(17)23)25(10(2)27)6-8-32-12(4)29/h5-8H2,1-4H3.
What are the key properties of 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate?
2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate has a molecular weight of 804.54 g/mol, XLogP of 3.71, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-acetyl-3-[acetyl(2-acetyloxyethyl)amino]-5-carbonochloridoyl-2,4,6-triiodoanilino]ethyl acetate is sourced from PubChem (CID 54455053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).