C22H24ClI3N2O11 — CID 87689030
[2,3-diacetyloxy-4-(3-carbonochloridoyl-N-[2,3-dihydroxypropyl(methyl)carbamoyl]-2,4,6-triiodoanilino)-4-oxobutyl] acetate (PubChem CID 87689030) has the molecular formula C22H24ClI3N2O11 and a molecular weight of 908.60 g/mol. Its IUPAC name is [2,3-diacetyloxy-4-(3-carbonochloridoyl-N-[2,3-dihydroxypropyl(methyl)carbamoyl]-2,4,6-triiodoanilino)-4-oxobutyl] acetate.
| Compound Name | [2,3-diacetyloxy-4-(3-carbonochloridoyl-N-[2,3-dihydroxypropyl(methyl)carbamoyl]-2,4,6-triiodoanilino)-4-oxobutyl] acetate |
|---|---|
| PubChem CID | 87689030 |
| Molecular Formula | C22H24ClI3N2O11 |
| Molecular Weight | 908.60 g/mol |
| Exact Mass | 907.82 |
| IUPAC Name | [2,3-diacetyloxy-4-(3-carbonochloridoyl-N-[2,3-dihydroxypropyl(methyl)carbamoyl]-2,4,6-triiodoanilino)-4-oxobutyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(=O)N(C(=O)N(C)CC(O)CO)c1c(I)cc(I)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C22H24ClI3N2O11/c1-9(30)37-8-15(38-10(2)31)19(39-11(3)32)21(35)28(22(36)27(4)6-12(33)7-29)18-14(25)5-13(24)16(17(18)26)20(23)34/h5,12,15,19,29,33H,6-8H2,1-4H3 |
| InChIKey | AVOQNYCMULGJQO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.60 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|