C44H56I3N3O24 — CID 173249334
[2,3,4,5-tetraacetyloxy-6-[[3-[(2-hydroxyacetyl)amino]-2,4,6-triiodo-5-[methyl(2,3,4,5,6-pentaacetyloxyhexyl)carbamoyl]benzoyl]-methylamino]hexyl] acetate (PubChem CID 173249334) has the molecular formula C44H56I3N3O24 and a molecular weight of 1391.64 g/mol. Its IUPAC name is [2,3,4,5-tetraacetyloxy-6-[[3-[(2-hydroxyacetyl)amino]-2,4,6-triiodo-5-[methyl(2,3,4,5,6-pentaacetyloxyhexyl)carbamoyl]benzoyl]-methylamino]hexyl] acetate.
| Compound Name | [2,3,4,5-tetraacetyloxy-6-[[3-[(2-hydroxyacetyl)amino]-2,4,6-triiodo-5-[methyl(2,3,4,5,6-pentaacetyloxyhexyl)carbamoyl]benzoyl]-methylamino]hexyl] acetate |
|---|---|
| PubChem CID | 173249334 |
| Molecular Formula | C44H56I3N3O24 |
| Molecular Weight | 1391.64 g/mol |
| Exact Mass | 1391.04 |
| IUPAC Name | [2,3,4,5-tetraacetyloxy-6-[[3-[(2-hydroxyacetyl)amino]-2,4,6-triiodo-5-[methyl(2,3,4,5,6-pentaacetyloxyhexyl)carbamoyl]benzoyl]-methylamino]hexyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(CN(C)C(=O)c1c(I)c(NC(=O)CO)c(I)c(C(=O)N(C)CC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O)c1I)OC(C)=O |
| InChI | InChI=1S/C44H56I3N3O24/c1-18(52)65-16-30(69-22(5)56)41(73-26(9)60)39(71-24(7)58)28(67-20(3)54)13-49(11)43(63)33-35(45)34(37(47)38(36(33)46)48-32(62)15-51)44(64)50(12)14-29(68-21(4)55)40(72-25(8)59)42(74-27(10)61)31(70-23(6)57)17-66-19(2)53/h28-31,39-42,51H,13-17H2,1-12H3,(H,48,62) |
| InChIKey | FTQHSTMODRRORF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 352.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1391.64 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|