C20H25NO2 — CID 129373539
2-[(8S,13S,14R,17S)-17-hydroxy-13-methyl-3-oxo-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]acetonitrile (PubChem CID 129373539) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-[(8S,13S,14R,17S)-17-hydroxy-13-methyl-3-oxo-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]acetonitrile.
| Compound Name | 2-[(8S,13S,14R,17S)-17-hydroxy-13-methyl-3-oxo-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]acetonitrile |
|---|---|
| PubChem CID | 129373539 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-[(8S,13S,14R,17S)-17-hydroxy-13-methyl-3-oxo-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]acetonitrile |
| SMILES | C[C@]12CC=C3C4=C(CC[C@H]3[C@H]1CC[C@]2(O)CC#N)CC(=O)CC4 |
| InChI | InChI=1S/C20H25NO2/c1-19-8-6-16-15-5-3-14(22)12-13(15)2-4-17(16)18(19)7-9-20(19,23)10-11-21/h6,17-18,23H,2-5,7-10,12H2,1H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | WUQMVSOZWZOUJR-ZRNYENFQSA-N |
| XLogP | 3.84 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |