C20H23NO2 — CID 169437251
2,2-dideuterio-2-[(8S,13S,14S,17R)-3,17-dihydroxy-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]acetonitrile (PubChem CID 169437251) has the molecular formula C20H23NO2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2,2-dideuterio-2-[(8S,13S,14S,17R)-3,17-dihydroxy-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]acetonitrile.
| Compound Name | 2,2-dideuterio-2-[(8S,13S,14S,17R)-3,17-dihydroxy-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]acetonitrile |
|---|---|
| PubChem CID | 169437251 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 2,2-dideuterio-2-[(8S,13S,14S,17R)-3,17-dihydroxy-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]acetonitrile |
| SMILES | [2H][13C]([2H])(C#N)[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)ccc4C3=CC[C@@]21C |
| InChI | InChI=1S/C20H23NO2/c1-19-8-6-16-15-5-3-14(22)12-13(15)2-4-17(16)18(19)7-9-20(19,23)10-11-21/h3,5-6,12,17-18,22-23H,2,4,7-10H2,1H3/t17-,18+,19+,20-/m1/s1/i10+1D2 |
| InChIKey | LPEAVAOTAWKUPC-KKFKAHQASA-N |
| XLogP | 3.80 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |