C23H32O3 — CID 70424295
(8S,13S,14S,17S)-3,3-dimethoxy-13-methyl-17-prop-1-ynyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 70424295) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (8S,13S,14S,17S)-3,3-dimethoxy-13-methyl-17-prop-1-ynyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,13S,14S,17S)-3,3-dimethoxy-13-methyl-17-prop-1-ynyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 70424295 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (8S,13S,14S,17S)-3,3-dimethoxy-13-methyl-17-prop-1-ynyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=C(CCC(OC)(OC)C4)C3=CC[C@@]21C |
| InChI | InChI=1S/C23H32O3/c1-5-11-22(24)13-10-20-19-7-6-16-15-23(25-3,26-4)14-9-17(16)18(19)8-12-21(20,22)2/h8,19-20,24H,6-7,9-10,12-15H2,1-4H3/t19-,20+,21+,22+/m1/s1 |
| InChIKey | HUIWUEOGQWRFKF-MLNNCEHLSA-N |
| XLogP | 4.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|