C25H40O5 — CID 87706906
(13S,17S)-3,3-dimethoxy-17-(methoxymethyl)-13-methyl-17-[(1R)-1-methylperoxyethyl]-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene (PubChem CID 87706906) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is (13S,17S)-3,3-dimethoxy-17-(methoxymethyl)-13-methyl-17-[(1R)-1-methylperoxyethyl]-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (13S,17S)-3,3-dimethoxy-17-(methoxymethyl)-13-methyl-17-[(1R)-1-methylperoxyethyl]-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 87706906 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (13S,17S)-3,3-dimethoxy-17-(methoxymethyl)-13-methyl-17-[(1R)-1-methylperoxyethyl]-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene |
| SMILES | COC[C@]1([C@@H](C)OOC)CCC2C3CCC4=C(CCC(OC)(OC)C4)C3=CC[C@@]21C |
| InChI | InChI=1S/C25H40O5/c1-17(30-29-6)24(16-26-3)13-11-22-21-8-7-18-15-25(27-4,28-5)14-10-19(18)20(21)9-12-23(22,24)2/h9,17,21-22H,7-8,10-16H2,1-6H3/t17-,21?,22?,23+,24+/m1/s1 |
| InChIKey | NJWKRTZRPMYMLQ-YXTCOGIXSA-N |
| XLogP | 5.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|