C14H22N2O2S — CID 129374038
methyl 3-[(3R)-3-methyl-4-(thiophen-2-ylmethyl)piperazin-1-yl]propanoate (PubChem CID 129374038) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is methyl 3-[(3R)-3-methyl-4-(thiophen-2-ylmethyl)piperazin-1-yl]propanoate.
| Compound Name | methyl 3-[(3R)-3-methyl-4-(thiophen-2-ylmethyl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 129374038 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | methyl 3-[(3R)-3-methyl-4-(thiophen-2-ylmethyl)piperazin-1-yl]propanoate |
| SMILES | COC(=O)CCN1CCN(Cc2cccs2)[C@H](C)C1 |
| InChI | InChI=1S/C14H22N2O2S/c1-12-10-15(6-5-14(17)18-2)7-8-16(12)11-13-4-3-9-19-13/h3-4,9,12H,5-8,10-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | JBTACGIUUCMXTE-GFCCVEGCSA-N |
| XLogP | 1.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |