C14H15NO3S — CID 129383103
N-(2-hydroxyethyl)-2-[(R)-naphthalen-2-ylsulfinyl]acetamide (PubChem CID 129383103) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[(R)-naphthalen-2-ylsulfinyl]acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[(R)-naphthalen-2-ylsulfinyl]acetamide |
|---|---|
| PubChem CID | 129383103 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[(R)-naphthalen-2-ylsulfinyl]acetamide |
| SMILES | O=C(C[S@@](=O)c1ccc2ccccc2c1)NCCO |
| InChI | InChI=1S/C14H15NO3S/c16-8-7-15-14(17)10-19(18)13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9,16H,7-8,10H2,(H,15,17)/t19-/m1/s1 |
| InChIKey | YJHHJCGAHKSABN-LJQANCHMSA-N |
| XLogP | 1.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |