C13H11NO2 — CID 129383941
(1aR,7bR)-2,2-dimethyl-3-oxo-1a,7b-dihydronaphtho[1,2-b]oxirene-6-carbonitrile (PubChem CID 129383941) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is (1aR,7bR)-2,2-dimethyl-3-oxo-1a,7b-dihydronaphtho[1,2-b]oxirene-6-carbonitrile.
| Compound Name | (1aR,7bR)-2,2-dimethyl-3-oxo-1a,7b-dihydronaphtho[1,2-b]oxirene-6-carbonitrile |
|---|---|
| PubChem CID | 129383941 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (1aR,7bR)-2,2-dimethyl-3-oxo-1a,7b-dihydronaphtho[1,2-b]oxirene-6-carbonitrile |
| SMILES | CC1(C)C(=O)c2ccc(C#N)cc2[C@H]2O[C@@H]21 |
| InChI | InChI=1S/C13H11NO2/c1-13(2)11(15)8-4-3-7(6-14)5-9(8)10-12(13)16-10/h3-5,10,12H,1-2H3/t10-,12+/m1/s1 |
| InChIKey | HUTDXSZZYGKSHK-PWSUYJOCSA-N |
| XLogP | 2.22 |
| TPSA | 53.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|