C12H15N — CID 12938517
spiro[1,2-dihydroindene-3,3'-pyrrolidine] (PubChem CID 12938517) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,3'-pyrrolidine].
| Compound Name | spiro[1,2-dihydroindene-3,3'-pyrrolidine] |
|---|---|
| PubChem CID | 12938517 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | spiro[1,2-dihydroindene-3,3'-pyrrolidine] |
| SMILES | c1ccc2c(c1)CCC21CCNC1 |
| InChI | InChI=1S/C12H15N/c1-2-4-11-10(3-1)5-6-12(11)7-8-13-9-12/h1-4,13H,5-9H2 |
| InChIKey | ALQRKFSWQNBCSJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |