C23H29NO — CID 129386848
(3S)-3-(phenoxymethyl)-1-[(1-phenylcyclobutyl)methyl]piperidine (PubChem CID 129386848) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (3S)-3-(phenoxymethyl)-1-[(1-phenylcyclobutyl)methyl]piperidine.
| Compound Name | (3S)-3-(phenoxymethyl)-1-[(1-phenylcyclobutyl)methyl]piperidine |
|---|---|
| PubChem CID | 129386848 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (3S)-3-(phenoxymethyl)-1-[(1-phenylcyclobutyl)methyl]piperidine |
| SMILES | c1ccc(OC[C@H]2CCCN(CC3(c4ccccc4)CCC3)C2)cc1 |
| InChI | InChI=1S/C23H29NO/c1-3-10-21(11-4-1)23(14-8-15-23)19-24-16-7-9-20(17-24)18-25-22-12-5-2-6-13-22/h1-6,10-13,20H,7-9,14-19H2/t20-/m0/s1 |
| InChIKey | UVVUONVLAXNWHL-FQEVSTJZSA-N |
| XLogP | 4.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |