C23H28ClNO — CID 58998520
(3S)-1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-(phenoxymethyl)piperidine (PubChem CID 58998520) has the molecular formula C23H28ClNO and a molecular weight of 369.94 g/mol. Its IUPAC name is (3S)-1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-(phenoxymethyl)piperidine.
| Compound Name | (3S)-1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-(phenoxymethyl)piperidine |
|---|---|
| PubChem CID | 58998520 |
| Molecular Formula | C23H28ClNO |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (3S)-1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-(phenoxymethyl)piperidine |
| SMILES | Clc1ccc(C2(CN3CCC[C@H](COc4ccccc4)C3)CCC2)cc1 |
| InChI | InChI=1S/C23H28ClNO/c24-21-11-9-20(10-12-21)23(13-5-14-23)18-25-15-4-6-19(16-25)17-26-22-7-2-1-3-8-22/h1-3,7-12,19H,4-6,13-18H2/t19-/m0/s1 |
| InChIKey | ZBWJLZQFMAYOJM-IBGZPJMESA-N |
| XLogP | 5.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |