C12H16N2OS — CID 129387522
(2S)-2-(4-aminophenyl)-3-propan-2-yl-1,3-thiazolidin-4-one (PubChem CID 129387522) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is (2S)-2-(4-aminophenyl)-3-propan-2-yl-1,3-thiazolidin-4-one.
| Compound Name | (2S)-2-(4-aminophenyl)-3-propan-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 129387522 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (2S)-2-(4-aminophenyl)-3-propan-2-yl-1,3-thiazolidin-4-one |
| SMILES | CC(C)N1C(=O)CS[C@H]1c1ccc(N)cc1 |
| InChI | InChI=1S/C12H16N2OS/c1-8(2)14-11(15)7-16-12(14)9-3-5-10(13)6-4-9/h3-6,8,12H,7,13H2,1-2H3/t12-/m0/s1 |
| InChIKey | YQHGWVGSBNPWKL-LBPRGKRZSA-N |
| XLogP | 2.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|