C13H12FNOS — CID 129389178
(3S)-7-fluoro-1,2,3,4-tetrahydrodibenzothiophene-3-carboxamide (PubChem CID 129389178) has the molecular formula C13H12FNOS and a molecular weight of 249.31 g/mol. Its IUPAC name is (3S)-7-fluoro-1,2,3,4-tetrahydrodibenzothiophene-3-carboxamide.
| Compound Name | (3S)-7-fluoro-1,2,3,4-tetrahydrodibenzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 129389178 |
| Molecular Formula | C13H12FNOS |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (3S)-7-fluoro-1,2,3,4-tetrahydrodibenzothiophene-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCc2c(sc3cc(F)ccc23)C1 |
| InChI | InChI=1S/C13H12FNOS/c14-8-2-4-10-9-3-1-7(13(15)16)5-11(9)17-12(10)6-8/h2,4,6-7H,1,3,5H2,(H2,15,16)/t7-/m0/s1 |
| InChIKey | WTEFZQXOGRVGCF-ZETCQYMHSA-N |
| XLogP | 2.63 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |