C14H15BrN2OS — CID 129392791
(2S)-2-(3-bromophenyl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide (PubChem CID 129392791) has the molecular formula C14H15BrN2OS and a molecular weight of 339.26 g/mol. Its IUPAC name is (2S)-2-(3-bromophenyl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide.
| Compound Name | (2S)-2-(3-bromophenyl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 129392791 |
| Molecular Formula | C14H15BrN2OS |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | (2S)-2-(3-bromophenyl)-2-[methyl(thiophen-3-ylmethyl)amino]acetamide |
| SMILES | CN(Cc1ccsc1)[C@H](C(N)=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H15BrN2OS/c1-17(8-10-5-6-19-9-10)13(14(16)18)11-3-2-4-12(15)7-11/h2-7,9,13H,8H2,1H3,(H2,16,18)/t13-/m0/s1 |
| InChIKey | WZDQQLMREDKDFZ-ZDUSSCGKSA-N |
| XLogP | 3.17 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |