C21H30FN3O2 — CID 129403478
(2R)-2-cyclohexyl-N-(3-fluoro-5-morpholin-4-ylphenyl)pyrrolidine-1-carboxamide (PubChem CID 129403478) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-N-(3-fluoro-5-morpholin-4-ylphenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-cyclohexyl-N-(3-fluoro-5-morpholin-4-ylphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 129403478 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (2R)-2-cyclohexyl-N-(3-fluoro-5-morpholin-4-ylphenyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(N2CCOCC2)c1)N1CCC[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C21H30FN3O2/c22-17-13-18(15-19(14-17)24-9-11-27-12-10-24)23-21(26)25-8-4-7-20(25)16-5-2-1-3-6-16/h13-16,20H,1-12H2,(H,23,26)/t20-/m1/s1 |
| InChIKey | CHDBFTHEPUURHA-HXUWFJFHSA-N |
| XLogP | 4.24 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |