C19H24FN5O2 — CID 126768067
N-(3-fluoro-5-morpholin-4-ylphenyl)-2-(1-methylpyrazol-4-yl)pyrrolidine-1-carboxamide (PubChem CID 126768067) has the molecular formula C19H24FN5O2 and a molecular weight of 373.43 g/mol. Its IUPAC name is N-(3-fluoro-5-morpholin-4-ylphenyl)-2-(1-methylpyrazol-4-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3-fluoro-5-morpholin-4-ylphenyl)-2-(1-methylpyrazol-4-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 126768067 |
| Molecular Formula | C19H24FN5O2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-(3-fluoro-5-morpholin-4-ylphenyl)-2-(1-methylpyrazol-4-yl)pyrrolidine-1-carboxamide |
| SMILES | Cn1cc(C2CCCN2C(=O)Nc2cc(F)cc(N3CCOCC3)c2)cn1 |
| InChI | InChI=1S/C19H24FN5O2/c1-23-13-14(12-21-23)18-3-2-4-25(18)19(26)22-16-9-15(20)10-17(11-16)24-5-7-27-8-6-24/h9-13,18H,2-8H2,1H3,(H,22,26) |
| InChIKey | KQIQFVWYBVOJKQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |