C17H21FN4O2 — CID 136553437
N-(3-fluoro-5-morpholin-4-ylphenyl)-2-methyl-2-pyrazol-1-ylpropanamide (PubChem CID 136553437) has the molecular formula C17H21FN4O2 and a molecular weight of 332.38 g/mol. Its IUPAC name is N-(3-fluoro-5-morpholin-4-ylphenyl)-2-methyl-2-pyrazol-1-ylpropanamide.
| Compound Name | N-(3-fluoro-5-morpholin-4-ylphenyl)-2-methyl-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 136553437 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-(3-fluoro-5-morpholin-4-ylphenyl)-2-methyl-2-pyrazol-1-ylpropanamide |
| SMILES | CC(C)(C(=O)Nc1cc(F)cc(N2CCOCC2)c1)n1cccn1 |
| InChI | InChI=1S/C17H21FN4O2/c1-17(2,22-5-3-4-19-22)16(23)20-14-10-13(18)11-15(12-14)21-6-8-24-9-7-21/h3-5,10-12H,6-9H2,1-2H3,(H,20,23) |
| InChIKey | ONLMLEARTYZCSC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |