C15H18FN5O2 — CID 91649292
1-(3-fluoro-5-morpholin-4-ylphenyl)-3-(1-methylpyrazol-3-yl)urea (PubChem CID 91649292) has the molecular formula C15H18FN5O2 and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-(3-fluoro-5-morpholin-4-ylphenyl)-3-(1-methylpyrazol-3-yl)urea.
| Compound Name | 1-(3-fluoro-5-morpholin-4-ylphenyl)-3-(1-methylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 91649292 |
| Molecular Formula | C15H18FN5O2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-(3-fluoro-5-morpholin-4-ylphenyl)-3-(1-methylpyrazol-3-yl)urea |
| SMILES | Cn1ccc(NC(=O)Nc2cc(F)cc(N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C15H18FN5O2/c1-20-3-2-14(19-20)18-15(22)17-12-8-11(16)9-13(10-12)21-4-6-23-7-5-21/h2-3,8-10H,4-7H2,1H3,(H2,17,18,19,22) |
| InChIKey | LSHOOQSLOVWXAL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |