C12H18O4Si — CID 129404190
(4S)-4-hydroxy-2,3-dimethoxy-4-(3-trimethylsilylprop-1-ynyl)cyclobut-2-en-1-one (PubChem CID 129404190) has the molecular formula C12H18O4Si and a molecular weight of 254.36 g/mol. Its IUPAC name is (4S)-4-hydroxy-2,3-dimethoxy-4-(3-trimethylsilylprop-1-ynyl)cyclobut-2-en-1-one.
| Compound Name | (4S)-4-hydroxy-2,3-dimethoxy-4-(3-trimethylsilylprop-1-ynyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 129404190 |
| Molecular Formula | C12H18O4Si |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (4S)-4-hydroxy-2,3-dimethoxy-4-(3-trimethylsilylprop-1-ynyl)cyclobut-2-en-1-one |
| SMILES | COC1=C(OC)[C@@](O)(C#CC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C12H18O4Si/c1-15-9-10(13)12(14,11(9)16-2)7-6-8-17(3,4)5/h14H,8H2,1-5H3/t12-/m1/s1 |
| InChIKey | PHWHZYURBSFKOE-GFCCVEGCSA-N |
| XLogP | 1.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|