C8H16O2S — CID 129405891
(2S,3S,4S,5S)-3,4-dimethoxy-2,5-dimethylthiolane (PubChem CID 129405891) has the molecular formula C8H16O2S and a molecular weight of 176.28 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3,4-dimethoxy-2,5-dimethylthiolane.
| Compound Name | (2S,3S,4S,5S)-3,4-dimethoxy-2,5-dimethylthiolane |
|---|---|
| PubChem CID | 129405891 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (2S,3S,4S,5S)-3,4-dimethoxy-2,5-dimethylthiolane |
| SMILES | CO[C@H]1[C@H](OC)[C@H](C)S[C@H]1C |
| InChI | InChI=1S/C8H16O2S/c1-5-7(9-3)8(10-4)6(2)11-5/h5-8H,1-4H3/t5-,6-,7+,8+/m0/s1 |
| InChIKey | HDNZXBHLHSZQSJ-RULNZFCNSA-N |
| XLogP | 1.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |