C10H15BrO3 — CID 129412769
(1S,4S,6S)-6-bromo-4-(hydroxymethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxylic acid (PubChem CID 129412769) has the molecular formula C10H15BrO3 and a molecular weight of 263.13 g/mol. Its IUPAC name is (1S,4S,6S)-6-bromo-4-(hydroxymethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxylic acid.
| Compound Name | (1S,4S,6S)-6-bromo-4-(hydroxymethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxylic acid |
|---|---|
| PubChem CID | 129412769 |
| Molecular Formula | C10H15BrO3 |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (1S,4S,6S)-6-bromo-4-(hydroxymethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxylic acid |
| SMILES | CC1(C)[C@]2(CO)CC[C@]1(C(=O)O)[C@H]2Br |
| InChI | InChI=1S/C10H15BrO3/c1-8(2)9(5-12)3-4-10(8,6(9)11)7(13)14/h6,12H,3-5H2,1-2H3,(H,13,14)/t6-,9-,10+/m0/s1 |
| InChIKey | BUENEWIZQLXVKL-JMOVZRAMSA-N |
| XLogP | 1.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|