C16H20N2OS — CID 129413196
(4S,4aS,8aR)-7,7-dimethyl-4-phenyl-2-sulfanylidene-3,4,4a,6,8,8a-hexahydro-1H-quinazolin-5-one (PubChem CID 129413196) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is (4S,4aS,8aR)-7,7-dimethyl-4-phenyl-2-sulfanylidene-3,4,4a,6,8,8a-hexahydro-1H-quinazolin-5-one.
| Compound Name | (4S,4aS,8aR)-7,7-dimethyl-4-phenyl-2-sulfanylidene-3,4,4a,6,8,8a-hexahydro-1H-quinazolin-5-one |
|---|---|
| PubChem CID | 129413196 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (4S,4aS,8aR)-7,7-dimethyl-4-phenyl-2-sulfanylidene-3,4,4a,6,8,8a-hexahydro-1H-quinazolin-5-one |
| SMILES | CC1(C)CC(=O)[C@@H]2[C@@H](c3ccccc3)NC(=S)N[C@@H]2C1 |
| InChI | InChI=1S/C16H20N2OS/c1-16(2)8-11-13(12(19)9-16)14(18-15(20)17-11)10-6-4-3-5-7-10/h3-7,11,13-14H,8-9H2,1-2H3,(H2,17,18,20)/t11-,13-,14-/m1/s1 |
| InChIKey | MFWGEYVZCRVRGU-MRVWCRGKSA-N |
| XLogP | 2.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|