C23H22N2O3 — CID 102491259
3,3-dimethyl-13-phenyl-4,4a,13,13a-tetrahydro-2H-indazolo[2,1-b]phthalazine-1,6,11-trione (PubChem CID 102491259) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3,3-dimethyl-13-phenyl-4,4a,13,13a-tetrahydro-2H-indazolo[2,1-b]phthalazine-1,6,11-trione.
| Compound Name | 3,3-dimethyl-13-phenyl-4,4a,13,13a-tetrahydro-2H-indazolo[2,1-b]phthalazine-1,6,11-trione |
|---|---|
| PubChem CID | 102491259 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3,3-dimethyl-13-phenyl-4,4a,13,13a-tetrahydro-2H-indazolo[2,1-b]phthalazine-1,6,11-trione |
| SMILES | CC1(C)CC(=O)C2C(C1)n1c(=O)c3ccccc3c(=O)n1C2c1ccccc1 |
| InChI | InChI=1S/C23H22N2O3/c1-23(2)12-17-19(18(26)13-23)20(14-8-4-3-5-9-14)25-22(28)16-11-7-6-10-15(16)21(27)24(17)25/h3-11,17,19-20H,12-13H2,1-2H3 |
| InChIKey | QNLCUZMZOUHVRV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |