C15H19N3O3 — CID 129414950
(3S)-N-[(1R)-1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]morpholine-3-carboxamide (PubChem CID 129414950) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is (3S)-N-[(1R)-1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]morpholine-3-carboxamide.
| Compound Name | (3S)-N-[(1R)-1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 129414950 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (3S)-N-[(1R)-1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]morpholine-3-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@@H]1COCCN1)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C15H19N3O3/c1-9(17-15(20)13-8-21-5-4-16-13)10-2-3-12-11(6-10)7-14(19)18-12/h2-3,6,9,13,16H,4-5,7-8H2,1H3,(H,17,20)(H,18,19)/t9-,13+/m1/s1 |
| InChIKey | UMKGWZOEPVCPNI-RNCFNFMXSA-N |
| XLogP | 0.35 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |