C19H33NO — CID 129418828
(5R,7R)-3-[(1R)-1-[[(2R)-5-methylhex-5-en-2-yl]amino]ethyl]adamantan-1-ol (PubChem CID 129418828) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (5R,7R)-3-[(1R)-1-[[(2R)-5-methylhex-5-en-2-yl]amino]ethyl]adamantan-1-ol.
| Compound Name | (5R,7R)-3-[(1R)-1-[[(2R)-5-methylhex-5-en-2-yl]amino]ethyl]adamantan-1-ol |
|---|---|
| PubChem CID | 129418828 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (5R,7R)-3-[(1R)-1-[[(2R)-5-methylhex-5-en-2-yl]amino]ethyl]adamantan-1-ol |
| SMILES | C=C(C)CC[C@@H](C)N[C@H](C)C12C[C@H]3C[C@@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C19H33NO/c1-13(2)5-6-14(3)20-15(4)18-8-16-7-17(9-18)11-19(21,10-16)12-18/h14-17,20-21H,1,5-12H2,2-4H3/t14-,15-,16-,17-,18?,19?/m1/s1 |
| InChIKey | XXGQHGQYXPGDMQ-FSLMHTPDSA-N |
| XLogP | 4.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|