C22H31N3O3 — CID 98271399
N-(2-acetamidophenyl)-2-[[(1S)-1-[(5S,7S)-3-hydroxy-1-adamantyl]ethyl]amino]acetamide (PubChem CID 98271399) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-(2-acetamidophenyl)-2-[[(1S)-1-[(5S,7S)-3-hydroxy-1-adamantyl]ethyl]amino]acetamide.
| Compound Name | N-(2-acetamidophenyl)-2-[[(1S)-1-[(5S,7S)-3-hydroxy-1-adamantyl]ethyl]amino]acetamide |
|---|---|
| PubChem CID | 98271399 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-(2-acetamidophenyl)-2-[[(1S)-1-[(5S,7S)-3-hydroxy-1-adamantyl]ethyl]amino]acetamide |
| SMILES | CC(=O)Nc1ccccc1NC(=O)CN[C@@H](C)C12C[C@@H]3C[C@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C22H31N3O3/c1-14(21-8-16-7-17(9-21)11-22(28,10-16)13-21)23-12-20(27)25-19-6-4-3-5-18(19)24-15(2)26/h3-6,14,16-17,23,28H,7-13H2,1-2H3,(H,24,26)(H,25,27)/t14-,16-,17-,21?,22?/m0/s1 |
| InChIKey | IGFMYNLJZJHLMB-ZCHKWMPYSA-N |
| XLogP | 2.89 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |