C27H36N2O3S — CID 129427799
N-[(6S)-6-tert-butyl-3-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-methylbenzamide (PubChem CID 129427799) has the molecular formula C27H36N2O3S and a molecular weight of 468.66 g/mol. Its IUPAC name is N-[(6S)-6-tert-butyl-3-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-methylbenzamide.
| Compound Name | N-[(6S)-6-tert-butyl-3-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 129427799 |
| Molecular Formula | C27H36N2O3S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N-[(6S)-6-tert-butyl-3-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2sc3c(c2C(=O)N2C[C@H](C)O[C@@H](C)C2)CC[C@H](C(C)(C)C)C3)c1 |
| InChI | InChI=1S/C27H36N2O3S/c1-16-8-7-9-19(12-16)24(30)28-25-23(26(31)29-14-17(2)32-18(3)15-29)21-11-10-20(27(4,5)6)13-22(21)33-25/h7-9,12,17-18,20H,10-11,13-15H2,1-6H3,(H,28,30)/t17-,18-,20-/m0/s1 |
| InChIKey | NYZMMEHGWOEGPQ-BJLQDIEVSA-N |
| XLogP | 5.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |