C26H33ClN2O3S — CID 29056919
N-[(6S)-6-tert-butyl-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-chlorobenzamide (PubChem CID 29056919) has the molecular formula C26H33ClN2O3S and a molecular weight of 489.08 g/mol. Its IUPAC name is N-[(6S)-6-tert-butyl-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-chlorobenzamide.
| Compound Name | N-[(6S)-6-tert-butyl-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 29056919 |
| Molecular Formula | C26H33ClN2O3S |
| Molecular Weight | 489.08 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[(6S)-6-tert-butyl-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-chlorobenzamide |
| SMILES | C[C@@H]1CN(C(=O)c2c(NC(=O)c3cccc(Cl)c3)sc3c2CC[C@H](C(C)(C)C)C3)C[C@@H](C)O1 |
| InChI | InChI=1S/C26H33ClN2O3S/c1-15-13-29(14-16(2)32-15)25(31)22-20-10-9-18(26(3,4)5)12-21(20)33-24(22)28-23(30)17-7-6-8-19(27)11-17/h6-8,11,15-16,18H,9-10,12-14H2,1-5H3,(H,28,30)/t15-,16-,18+/m1/s1 |
| InChIKey | NUFFFWCZKLJYJP-NUJGCVRESA-N |
| XLogP | 6.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.08 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |