C23H28N2O3S — CID 7673722
N-[(6R)-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide (PubChem CID 7673722) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is N-[(6R)-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide.
| Compound Name | N-[(6R)-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 7673722 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[(6R)-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide |
| SMILES | C[C@@H]1CCc2c(sc(NC(=O)c3ccccc3)c2C(=O)N2C[C@@H](C)O[C@H](C)C2)C1 |
| InChI | InChI=1S/C23H28N2O3S/c1-14-9-10-18-19(11-14)29-22(24-21(26)17-7-5-4-6-8-17)20(18)23(27)25-12-15(2)28-16(3)13-25/h4-8,14-16H,9-13H2,1-3H3,(H,24,26)/t14-,15-,16-/m1/s1 |
| InChIKey | FVNICEYKIMFZCU-BZUAXINKSA-N |
| XLogP | 4.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |