C24H32N2O3S2 — CID 26815309
N-[(6S)-6-tert-butyl-3-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]thiophene-2-carboxamide (PubChem CID 26815309) has the molecular formula C24H32N2O3S2 and a molecular weight of 460.67 g/mol. Its IUPAC name is N-[(6S)-6-tert-butyl-3-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[(6S)-6-tert-butyl-3-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26815309 |
| Molecular Formula | C24H32N2O3S2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[(6S)-6-tert-butyl-3-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]thiophene-2-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)c2c(NC(=O)c3cccs3)sc3c2CC[C@H](C(C)(C)C)C3)C[C@H](C)O1 |
| InChI | InChI=1S/C24H32N2O3S2/c1-14-12-26(13-15(2)29-14)23(28)20-17-9-8-16(24(3,4)5)11-19(17)31-22(20)25-21(27)18-7-6-10-30-18/h6-7,10,14-16H,8-9,11-13H2,1-5H3,(H,25,27)/t14-,15+,16-/m0/s1 |
| InChIKey | PZUWGYBAVJYEQB-XHSDSOJGSA-N |
| XLogP | 5.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |