C18H14N4O2 — CID 129431951
5-phenyl-N-[[(Z)-3-phenylprop-2-enylidene]amino]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 129431951) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 5-phenyl-N-[[(Z)-3-phenylprop-2-enylidene]amino]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-phenyl-N-[[(Z)-3-phenylprop-2-enylidene]amino]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 129431951 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 5-phenyl-N-[[(Z)-3-phenylprop-2-enylidene]amino]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | O=C(NN=C/C=C\c1ccccc1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H14N4O2/c23-16(20-19-13-7-10-14-8-3-1-4-9-14)18-22-21-17(24-18)15-11-5-2-6-12-15/h1-13H,(H,20,23)/b10-7-,19-13? |
| InChIKey | BUYZBOIYIRPODF-MELGKKFQSA-N |
| XLogP | 3.17 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|